For research use only. Not for therapeutic Use.
Guanidine Hydrochloride（Cat No.:A000737）is a strong chaotropic agent used in molecular biology and biochemistry to denature proteins and nucleic acids, aiding in their study and purification. It disrupts hydrogen bonds and hydrophobic interactions, making it valuable in protein folding and unfolding studies. Guanidine HCl is also utilized in the extraction of DNA and RNA from cells. In clinical settings, it can be used as a treatment for myasthenia gravis by enhancing acetylcholine release at neuromuscular junctions. Common side effects include gastrointestinal disturbances and potential toxicity with prolonged use.
| Catalog Number | A000737 |
| CAS Number | 50-01-1 |
| Synonyms | Aminoformamidine HCl |
| Molecular Formula | CH5N3.HCl |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | 3 years -20C powder |
| IUPAC Name | guanidine;hydrochloride |
| InChI | InChI=1S/CH5N3.ClH/c2-1(3)4;/h(H5,2,3,4);1H |
| InChIKey | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| SMILES | C(=N)(N)N.Cl |
