For research use only. Not for therapeutic Use.
Guanine-15N5(Cat No.:R028111) is a high-purity isotopically labeled compound essential for advanced biochemical and pharmaceutical research. Featuring five nitrogen-15 atoms, this labeled version of guanine is crucial for studying nucleic acid metabolism, DNA and RNA synthesis, and genetic mechanisms. It enhances precision and accuracy in analytical techniques such as mass spectrometry and NMR spectroscopy, ensuring reliable and reproducible results. Ideal for genetic research, drug development, and molecular biology studies, Guanine-15N5 integrates seamlessly into existing research protocols, providing a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 168566-53-8 |
Synonyms | 2-Amino-1,9-dihydro-6H-purin-6-one-4,8-15N5; 2-Amino-6-hydroxy-1H-purine-15N5; 2-Amino-6-hydroxypurine-15N5; 2-Aminohypoxanthine-15N5; 9H-Guanine-15N5; 2-Amino-hypoxanthine-15N5; |
Molecular Formula | C5H5N5O |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | 2-(15N)azanyl-1,7-dihydropurin-6-one |
InChI | InChI=1S/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)/i6+1,7+1,8+1,9+1,10+1 |
InChIKey | UYTPUPDQBNUYGX-CIKZIQIKSA-N |
SMILES | C1=[15N]C2=C([15NH]1)C(=O)[15NH]C(=[15N]2)[15NH2] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |