For research use only. Not for therapeutic Use.
Guanine hydrochloride (Cat.No:R070065) is a crystalline compound derived from guanine, one of the four nucleobases essential for the structure of DNA and RNA. It serves as a key component in the study of nucleic acid chemistry and is employed in various biochemical and pharmaceutical research applications.
CAS Number | 635-39-2 |
Synonyms | 2-Aminohypoxanthine hydrochloride |
Molecular Formula | C5H6ClN5O |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 2-amino-3,7-dihydropurin-6-one;hydrochloride |
InChI | InChI=1S/C5H5N5O.ClH/c6-5-9-3-2(4(11)10-5)7-1-8-3;/h1H,(H4,6,7,8,9,10,11);1H |
InChIKey | IBAOFQIOOBQLHE-UHFFFAOYSA-N |
SMILES | C1=NC2=C(N1)C(=O)N=C(N2)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |