For research use only. Not for therapeutic Use.
Guggulsterone (Cat.No:I010496) is a natural compound derived from the resin of the Commiphora mukul tree, commonly known as guggul. It has been used in traditional Ayurvedic medicine for its anti-inflammatory and lipid-lowering properties. Guggulsterone has shown potential in managing conditions like high cholesterol, obesity, and inflammatory disorders through its modulation of various signaling pathways.
| Catalog Number | I010496 |
| CAS Number | 95975-55-6 |
| Synonyms | Pregna-4,17(20)-diene-3,16-dione |
| Molecular Formula | C21H28O2 |
| Purity | ≥95% |
| Target | MAPK/ERK Pathway |
| Solubility | Soluble to 10 mM in ethanol with gentle warming |
| Storage | Store at RT |
| IUPAC Name | (8R,9S,10R,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,16-dione |
| InChI | 1S/C21H28O2/c1-4-16-19(23)12-18-15-6-5-13-11-14(22)7-9-20(13,2)17(15)8-10-21(16,18)3/h4,11,15,17-18H,5-10,12H2,1-3H3/b16-4+/t15-,17+,18+,20+,21-/m1/s1 |
| InChIKey | WDXRGPWQVHZTQJ-OSJVMJFVSA-N |
| SMILES | C/C=C/1\C(=O)C[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C |
