For research use only. Not for therapeutic Use.
GW-3333(Cat No.:I007144)is a small molecule inhibitor that targets the enzyme autotaxin (ATX), which is involved in the production of lysophosphatidic acid (LPA), a lipid mediator that plays a role in various biological processes, including cell migration, proliferation, and inflammation. By inhibiting autotaxin, GW-3333 reduces LPA production, which may help in treating diseases where LPA is implicated, such as cancer, fibrosis, and autoimmune disorders. GW-3333 has shown promise in preclinical studies, suggesting potential therapeutic applications in cancer treatment and other LPA-related diseases, although further clinical research is needed.
CAS Number | 212609-68-2 |
Synonyms | GW-3333; GW3333; GW 3333;;(2R,3S)-3-(Formyl-hydroxyamino)-2-(2-methyl-1-propyl)-4-methylpentanoic acid, ((1S,2S)-2-methyl-1-(2-pyridylcarbamoyl)-1-butyl)amide |
Molecular Formula | C22H36N4O4 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | Soluble in DMSO |
Storage | 0 - 4°C for short term or -20 °C for long term |
IUPAC Name | (2R,3S)-3-[formyl(hydroxy)amino]-4-methyl-N-[(2S,3S)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]-2-(2-methylpropyl)pentanamide |
InChI | InChI=1S/C22H36N4O4/c1-7-16(6)19(22(29)24-18-10-8-9-11-23-18)25-21(28)17(12-14(2)3)20(15(4)5)26(30)13-27/h8-11,13-17,19-20,30H,7,12H2,1-6H3,(H,25,28)(H,23,24,29)/t16-,17+,19-,20-/m0/s1 |
InChIKey | SMZPWUUYPYYHIV-HNJRGHQBSA-N |
SMILES | CC[C@H](C)[C@@H](C(=O)NC1=CC=CC=N1)NC(=O)[C@H](CC(C)C)[C@H](C(C)C)N(C=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |