For research use only. Not for therapeutic Use.
GW-7647 (Cat.No:I007156) is a synthetic peroxisome proliferator-activated receptor alpha (PPARα) agonist. It has been investigated for its potential in the treatment of metabolic disorders such as dyslipidemia and insulin resistance. GW-7647 activates PPARα, leading to the regulation of lipid metabolism and improvement in glucose homeostasis. Clinical studies have shown its therapeutic potential in managing cardiovascular and metabolic diseases.
| Catalog Number | I007156 |
| CAS Number | 265129-71-3 |
| Synonyms | GW-7647; GW 7647; GW7647.;2-((4-(2-(3-cyclohexyl-1-(4-cyclohexylbutyl)ureido)ethyl)phenyl)thio)-2-methylpropanoic acid |
| Molecular Formula | C29H46N2O3S |
| Purity | ≥95% |
| Target | Vitamin D Related/Nuclear Receptor |
| Solubility | Soluble in DMSO |
| Storage | Store at RT |
| IUPAC Name | 2-[4-[2-[4-cyclohexylbutyl(cyclohexylcarbamoyl)amino]ethyl]phenyl]sulfanyl-2-methylpropanoic acid |
| InChI | InChI=1S/C29H46N2O3S/c1-29(2,27(32)33)35-26-18-16-24(17-19-26)20-22-31(28(34)30-25-14-7-4-8-15-25)21-10-9-13-23-11-5-3-6-12-23/h16-19,23,25H,3-15,20-22H2,1-2H3,(H,30,34)(H,32,33) |
| InChIKey | PKNYXWMTHFMHKD-UHFFFAOYSA-N |
| SMILES | O=C(NC1CCCCC1)N(CCCCC1CCCCC1)CCc1ccc(cc1)SC(C)(C)C(=O)O |
| Reference | </br> 1:Strömqvist M, Olsson JA, Kärrman A, Brunström B. Transcription of genes involved in fat metabolism in chicken embryos exposed to the peroxisome proliferator-activated receptor alpha (PPARα) agonist GW7647 or to perfluorooctane sulfonate (PFOS) or perfluorooctanoic acid (PFOA). Comp Biochem Physiol C Toxicol Pharmacol. 2012 Jun;156(1):29-36. doi: 10.1016/j.cbpc.2012.03.004. PubMed PMID: 22465071. |
