For research use only. Not for therapeutic Use.
GW 788388-d5(Cat No.:R041606) is a high-purity deuterated compound, crucial for advanced pharmaceutical and biochemical research. This isotopically labeled version of GW 788388, featuring five deuterium atoms, is essential for studies involving TGF-β receptor inhibitors, fibrosis, and cancer research. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of pharmacokinetic and metabolic pathway analysis. With improved stability and consistency, GW 788388-d5 integrates seamlessly into various experimental setups, providing a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | R041606 |
CAS Number | NA |
Synonyms | 4-[4-[3-(2-Pyridinyl)-1H-pyrazol-4-yl]-2-pyridinyl]-N-(tetrahydro-2H-pyran-4-yl)benzamide-d5; |
Molecular Formula | C₂₅H₁₈D₅N₅O₂ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-(3,3,4,5,5-pentadeuteriooxan-4-yl)-4-[4-(5-pyridin-2-yl-1H-pyrazol-4-yl)pyridin-2-yl]benzamide |
InChI | InChI=1S/C25H23N5O2/c31-25(29-20-9-13-32-14-10-20)18-6-4-17(5-7-18)23-15-19(8-12-27-23)21-16-28-30-24(21)22-3-1-2-11-26-22/h1-8,11-12,15-16,20H,9-10,13-14H2,(H,28,30)(H,29,31)/i9D2,10D2,20D |
InChIKey | SAGZIBJAQGBRQA-FNZRGOEOSA-N |
SMILES | [2H]C1(COCC(C1([2H])NC(=O)C2=CC=C(C=C2)C3=NC=CC(=C3)C4=C(NN=C4)C5=CC=CC=N5)([2H])[2H])[2H] |