For research use only. Not for therapeutic Use.
GW2580(CAT: I005240) is a highly selective inhibitor of the colony-stimulating factor 1 receptor (CSF1R), widely utilized in immunology and oncology research. By targeting CSF1R, it effectively blocks the survival, proliferation, and differentiation of macrophages, making it a valuable tool for studying macrophage-related signaling pathways. Researchers use GW2580 to explore the role of CSF1R in tumor microenvironments, chronic inflammatory diseases, and autoimmune disorders. Its specificity and efficacy make it an essential compound for preclinical studies aiming to develop therapeutic strategies targeting macrophage-mediated processes in cancer and immune regulation.
| Catalog Number | I005240 |
| CAS Number | 870483-87-7 |
| Synonyms | 5-[[3-methoxy-4-[(4-methoxyphenyl)methoxy]phenyl]methyl]pyrimidine-2,4-diamine |
| Molecular Formula | C₂₀H₂₂N₄O₃ |
| Purity | ≥95% |
| Target | c-Fms |
| Solubility | DMSO: ≤ 17.5 mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 60 nM (100% inhibition in vitro) [1] |
| IUPAC Name | 5-[[3-methoxy-4-[(4-methoxyphenyl)methoxy]phenyl]methyl]pyrimidine-2,4-diamine |
| InChI | InChI=1S/C20H22N4O3/c1-25-16-6-3-13(4-7-16)12-27-17-8-5-14(10-18(17)26-2)9-15-11-23-20(22)24-19(15)21/h3-8,10-11H,9,12H2,1-2H3,(H4,21,22,23,24) |
| InChIKey | MYQAUKPBNJWPIE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC2=C(C=C(C=C2)CC3=CN=C(N=C3N)N)OC |
