For research use only. Not for therapeutic Use.
GW409544(CAT: I007147) is a potent and selective agonist of peroxisome proliferator-activated receptor-gamma (PPAR-γ), a nuclear receptor integral to glucose and lipid metabolism regulation. This compound enhances PPAR-γ activity, promoting insulin sensitivity and adipogenesis, making it particularly valuable in metabolic research. Widely used to study type 2 diabetes and obesity-related conditions, GW409544 helps elucidate the mechanisms underlying PPAR-γ’s role in metabolic homeostasis. It serves as a critical tool for the development of novel therapeutic agents targeting metabolic disorders, advancing research in diabetes management and lipid regulation.
| CAS Number | 258345-41-4 |
| Synonyms | GW409544; GW 409544; GW-409544.;(2S)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-[[(Z)-4-oxo-4-phenylbut-2-en-2-yl]amino]propanoic acid |
| Molecular Formula | C31H30N2O5 |
| Purity | ≥95% |
| Target | PPAR Agonist |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term or -20 °C for long term |
| IUPAC Name | (2S)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-[[(Z)-4-oxo-4-phenylbut-2-en-2-yl]amino]propanoic acid |
| InChI | InChI=1S/C31H30N2O5/c1-21(19-29(34)24-9-5-3-6-10-24)32-28(31(35)36)20-23-13-15-26(16-14-23)37-18-17-27-22(2)38-30(33-27)25-11-7-4-8-12-25/h3-16,19,28,32H,17-18,20H2,1-2H3,(H,35,36)/b21-19-/t28-/m0/s1 |
| InChIKey | GGUVRMBIEPYOKL-WMVCGJOFSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CC=C2)CCOC3=CC=C(C=C3)CC(C(=O)O)NC(=CC(=O)C4=CC=CC=C4)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
