For research use only. Not for therapeutic Use.
GW542573X(Cat No.:R040345)is a selective small molecule inhibitor that targets specific enzymes involved in inflammatory and immune responses. It has shown potential in modulating pathways linked to autoimmune diseases, such as rheumatoid arthritis and lupus, by inhibiting key receptors and signaling molecules involved in the immune system’s activation. In preclinical studies, GW542573X has demonstrated the ability to reduce inflammation and suppress immune cell activation, offering promise as a therapeutic candidate for treating chronic inflammatory disorders. Ongoing research is focused on evaluating its safety, efficacy, and potential clinical applications in immune-mediated diseases.
CAS Number | 660846-41-3 |
Synonyms | tert-butyl 4-[(2-methoxyphenyl)carbamoyloxymethyl]piperidine-1-carboxylate |
Molecular Formula | C19H28N2O5 |
Purity | ≥95% |
IUPAC Name | tert-butyl 4-[(2-methoxyphenyl)carbamoyloxymethyl]piperidine-1-carboxylate |
InChI | InChI=1S/C19H28N2O5/c1-19(2,3)26-18(23)21-11-9-14(10-12-21)13-25-17(22)20-15-7-5-6-8-16(15)24-4/h5-8,14H,9-13H2,1-4H3,(H,20,22) |
InChIKey | SAXGSDIZIYFNKD-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)COC(=O)NC2=CC=CC=C2OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |