For research use only. Not for therapeutic Use.
GW779439X（Cat No.:I012588）is a selective inhibitor of the serotonin transporter (SERT), a protein involved in serotonin reuptake in the brain. By inhibiting SERT, GW779439X increases serotonin levels in the synaptic cleft, which has potential therapeutic implications for mood disorders such as depression and anxiety. It is commonly used in research to study serotonin’s role in mood regulation and the effects of SERT inhibition on neurotransmitter dynamics. Its selectivity for SERT over other transporters makes GW779439X valuable for understanding serotonin-specific pathways and for developing targeted antidepressant therapies.
| Catalog Number | I012588 |
| CAS Number | 551919-98-3 |
| Synonyms | N-[4-(4-Methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin- 2-amine |
| Molecular Formula | C22H21F3N8 |
| Purity | ≥95% |
| Target | Epigenetics |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine |
| InChI | InChI=1S/C22H21F3N8/c1-31-9-11-32(12-10-31)20-5-4-15(13-17(20)22(23,24)25)29-21-26-8-6-18(30-21)16-14-28-33-19(16)3-2-7-27-33/h2-8,13-14H,9-12H2,1H3,(H,26,29,30) |
| InChIKey | ZOTNSCLLJKXGSD-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)NC3=NC=CC(=N3)C4=C5C=CC=NN5N=C4)C(F)(F)F |
