For research use only. Not for therapeutic Use.
GW788388 is a selective and potent inhibitor of TGF-β type I receptor (ALK5), which plays a crucial role in mediating TGF-β signaling involved in cell growth, differentiation, and immune regulation. By blocking this pathway, GW788388 has shown promise in preclinical studies for inhibiting fibrosis, cancer progression, and inflammatory diseases. It is being investigated for its therapeutic potential in conditions such as liver fibrosis, kidney fibrosis, and cancer, where TGF-β signaling contributes to disease progression and pathogenesis.
CAS Number | 452342-67-5 |
Synonyms | N-(oxan-4-yl)-4-[4-(5-pyridin-2-yl-1H-pyrazol-4-yl)pyridin-2-yl]benzamide |
Molecular Formula | C₂₅H₂₃N₅O₂ |
Purity | ≥95% |
Target | TGF-β Receptor |
Solubility | DMSO: ≥ 48 mg/mL |
Storage | 2-8°C |
IC50 | 18 nM |
IUPAC Name | N-(oxan-4-yl)-4-[4-(5-pyridin-2-yl-1H-pyrazol-4-yl)pyridin-2-yl]benzamide |
InChI | InChI=1S/C25H23N5O2/c31-25(29-20-9-13-32-14-10-20)18-6-4-17(5-7-18)23-15-19(8-12-27-23)21-16-28-30-24(21)22-3-1-2-11-26-22/h1-8,11-12,15-16,20H,9-10,13-14H2,(H,28,30)(H,29,31) |
InChIKey | SAGZIBJAQGBRQA-UHFFFAOYSA-N |
SMILES | C1COCCC1NC(=O)C2=CC=C(C=C2)C3=NC=CC(=C3)C4=C(NN=C4)C5=CC=CC=N5 |