For research use only. Not for therapeutic Use.
H-ALA-ALA-GLY-OH(Cat No.:M088411)is a high-purity tripeptide composed of two alanine (ALA) residues followed by a glycine (GLY) residue. This peptide sequence is commonly used in biochemical and pharmaceutical research as a model system for studying protein structure, function, and peptide interactions. Its simplicity and stability make it valuable for investigating peptide bond formation, enzymatic processes, and protein folding mechanisms. H-ALA-ALA-GLY-OH is essential for precise research applications, contributing to advancements in understanding peptide behavior, protein synthesis, and drug development.
CAS Number | 16422-07-4 |
Molecular Formula | C8H15N3O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]acetic acid |
InChI | InChI=1S/C8H15N3O4/c1-4(9)7(14)11-5(2)8(15)10-3-6(12)13/h4-5H,3,9H2,1-2H3,(H,10,15)(H,11,14)(H,12,13)/t4-,5-/m0/s1 |
InChIKey | RLMISHABBKUNFO-WHFBIAKZSA-N |
SMILES | CC(C(=O)NC(C)C(=O)NCC(=O)O)N |