For research use only. Not for therapeutic Use.
H-D-Homoser-OH(CAT: R072481) is a homoserine derivative used primarily in peptide synthesis and as a building block for the preparation of bioactive compounds. Its structure, featuring a homoserine backbone, makes it valuable in the development of molecules targeting enzymatic processes, including protease inhibition and metabolic regulation. This compound is explored in immunology research for its potential to modulate cytokine release and influence immune cell function. H-D-Homoser-OH is particularly useful in the design of peptides for therapeutic intervention in inflammatory and autoimmune diseases, offering a way to specifically target and regulate immune responses.
CAS Number | 6027-21-0 |
Synonyms | (2R)-2-amino-4-hydroxybutanoic acid |
Molecular Formula | C4H9NO3 |
Purity | ≥95% |
IUPAC Name | (2R)-2-amino-4-hydroxybutanoic acid |
InChI | InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m1/s1 |
InChIKey | UKAUYVFTDYCKQA-GSVOUGTGSA-N |
SMILES | C(CO)C(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |