For research use only. Not for therapeutic Use.
H-D-Met-OMe.HCl（Cat No.:R061463）is a modified derivative of the amino acid D-methionine (D-Met), where the carboxyl group is methylated with a methoxy (OMe) group. This methylation prevents unwanted reactions during peptide synthesis, making it easier to incorporate D-methionine into peptides. The compound is in its hydrochloride (HCl) salt form, which enhances its solubility in aqueous solutions. H-D-Met-OMe.HCl is commonly used in solid-phase peptide synthesis (SPPS) to study protein structure, peptide stability, and function. It also has potential applications in drug discovery, particularly for designing peptides with unique biological activities.
| CAS Number | 69630-60-0 |
| Synonyms | methyl (2R)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| Molecular Formula | C6H14ClNO2S |
| Purity | ≥95% |
| IUPAC Name | methyl (2R)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| InChI | InChI=1S/C6H13NO2S.ClH/c1-9-6(8)5(7)3-4-10-2;/h5H,3-4,7H2,1-2H3;1H/t5-;/m1./s1 |
| InChIKey | MEVUPUNLVKELNV-NUBCRITNSA-N |
| SMILES | COC(=O)[C@@H](CCSC)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
