For research use only. Not for therapeutic Use.
H-GAMMA-GLU-ABU-OH(Cat No.:M077628) is a peptide with the sequence gamma-glutamylaminobutyric acid (gamma-Glu-ABU) and an additional hydroxyl group (OH) at the carboxyl terminus. This peptide derivative is often used in biochemical research and drug development due to its ability to mimic certain biological molecules and interactions. It may serve as a model compound for studying the structure-activity relationships of peptides or as a building block in the synthesis of more complex peptide-based drugs or probes.
CAS Number | 16869-42-4 |
Molecular Formula | C9H16N2O5 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (2S)-2-amino-5-[[(1S)-1-carboxypropyl]amino]-5-oxopentanoic acid |
InChI | InChI=1S/C9H16N2O5/c1-2-6(9(15)16)11-7(12)4-3-5(10)8(13)14/h5-6H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t5-,6-/m0/s1 |
InChIKey | FUZOZPRKGAXGOB-WDSKDSINSA-N |
SMILES | CCC(C(=O)O)NC(=O)CCC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |