For research use only. Not for therapeutic Use.
H-GLY-LEU-PHE-OH (Cat.No:M012190) is a tripeptide with the sequence glycine-leucine-phenylalanine. This peptide plays a significant role in various physiological processes and serves as a fundamental component in peptide research. Its simple structure and specific sequence make it a valuable tool in studying peptide synthesis, structure-activity relationships, and biological functions.
CAS Number | 103213-38-3 |
Molecular Formula | C17H25N3O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
InChI | InChI=1S/C17H25N3O4/c1-11(2)8-13(19-15(21)10-18)16(22)20-14(17(23)24)9-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10,18H2,1-2H3,(H,19,21)(H,20,22)(H,23,24)/t13-,14-/m0/s1 |
InChIKey | TVUWMSBGMVAHSJ-KBPBESRZSA-N |
SMILES | CC(C)CC(C(=O)NC(CC1=CC=CC=C1)C(=O)O)NC(=O)CN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |