For research use only. Not for therapeutic Use.
H-His-Ala-OH(Cat No.:M078499) is a dipeptide consisting of the amino acids histidine (His) and alanine (Ala), linked together in a specific sequence. The “H-” at the beginning indicates the presence of a free amino group on the histidine, while “-OH” at the end signifies a free carboxyl group on the alanine, making it a free dipeptide. This dipeptide is utilized in biochemistry and molecular biology studies to understand peptide behavior, peptide bonding, and the biochemical properties of these amino acids. It also serves as a building block in the synthesis of more complex peptides and proteins.
CAS Number | 16874-75-2 |
Molecular Formula | C9H14N4O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoic acid |
InChI | InChI=1S/C9H14N4O3/c1-5(9(15)16)13-8(14)7(10)2-6-3-11-4-12-6/h3-5,7H,2,10H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t5-,7-/m0/s1 |
InChIKey | FRJIAZKQGSCKPQ-FSPLSTOPSA-N |
SMILES | CC(C(=O)O)NC(=O)C(CC1=CN=CN1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |