For research use only. Not for therapeutic Use.
H-Ile-OtBu.HCl（Cat No.:R061186）is the tert-butyl ester derivative of isoleucine, where the carboxyl group of isoleucine is esterified with a tert-butyl group (OtBu), and the compound is in its hydrochloride salt form (HCl). This modification enhances the stability, solubility, and lipophilicity of the compound, making it useful in peptide synthesis. The tert-butyl ester provides protection for the carboxyl group, preventing unwanted reactions during peptide formation. H-Ile-OtBu.HCl is often employed in bioactive peptide research, drug development, and studies related to metabolic diseases, cancer, and other therapeutic areas requiring stable, bioavailable peptides.
| CAS Number | 69320-89-4 |
| Synonyms | tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
| Molecular Formula | C10H22ClNO2 |
| Purity | ≥95% |
| IUPAC Name | tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChI | InChI=1S/C10H21NO2.ClH/c1-6-7(2)8(11)9(12)13-10(3,4)5;/h7-8H,6,11H2,1-5H3;1H/t7-,8-;/m0./s1 |
| InChIKey | IFRYMHOZFAPYPJ-WSZWBAFRSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC(C)(C)C)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
