For research use only. Not for therapeutic Use.
H-Lys-OMe.2HCl（Cat No.:R012919）is a methyl ester derivative of lysine, where the amino acid’s carboxyl group is esterified with methanol (OMe), and the compound exists as a hydrochloride salt with two molecules of HCl. This modification improves the solubility and stability of the compound, making it suitable for peptide synthesis and biochemical studies. H-Lys-OMe.2HCl is commonly used in research involving protein interactions, enzyme activity, and peptide-based drug development. It plays a role in studying the structural properties and therapeutic potential of bioactive peptides, particularly in areas like metabolic diseases and cancer.
| CAS Number | 26348-70-9 |
| Synonyms | methyl (2S)-2,6-diaminohexanoate;dihydrochloride |
| Molecular Formula | C7H18Cl2N2O2 |
| Purity | ≥95% |
| IUPAC Name | methyl (2S)-2,6-diaminohexanoate;dihydrochloride |
| InChI | InChI=1S/C7H16N2O2.2ClH/c1-11-7(10)6(9)4-2-3-5-8;;/h6H,2-5,8-9H2,1H3;2*1H/t6-;;/m0../s1 |
| InChIKey | SXZCBVCQHOJXDR-ILKKLZGPSA-N |
| SMILES | COC(=O)[C@H](CCCCN)N.Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
