For research use only. Not for therapeutic Use.
H-Met-Met-OH（Cat No.:I042875）is a dipeptide composed of two methionine (Met) amino acids linked by a peptide bond, with a free carboxyl group at the C-terminus. It is often used in research to study protein synthesis, peptide interactions, and the effects of methionine-containing peptides on biological processes. This compound can serve as a model for studying sulfur-containing amino acids in various biochemical pathways. H-Met-Met-OH may also have potential applications in metabolic research, as methionine plays a key role in cellular metabolism and antioxidant defense mechanisms.
| CAS Number | 7349-78-2 |
| Synonyms | (2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
| Molecular Formula | C10H20N2O3S2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
| InChI | InChI=1S/C10H20N2O3S2/c1-16-5-3-7(11)9(13)12-8(10(14)15)4-6-17-2/h7-8H,3-6,11H2,1-2H3,(H,12,13)(H,14,15)/t7-,8-/m0/s1 |
| InChIKey | ZYTPOUNUXRBYGW-YUMQZZPRSA-N |
| SMILES | CSCC[C@@H](C(=O)N[C@@H](CCSC)C(=O)O)N |
