For research use only. Not for therapeutic Use.
H-Thr(tBu)-OMe.HCl（Cat No.:I043014）is a derivative of threonine where the hydroxyl group on the side chain is protected by a tert-butyl (tBu) group, and the carboxyl group is esterified with methanol (OMe). The compound is in its hydrochloride salt form (HCl), enhancing solubility and stability. The tert-butyl protection prevents unwanted reactions during peptide synthesis, while the methyl ester modification increases lipophilicity. H-Thr(tBu)-OMe.HCl is useful in peptide chemistry, bioactive peptide research, and drug development, particularly in the design of therapeutic peptides for applications in cancer, metabolic disorders, and neurological diseases.
| CAS Number | 71989-43-0 |
| Synonyms | methyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate;hydrochloride |
| Molecular Formula | C9H20ClNO3 |
| Purity | ≥95% |
| IUPAC Name | methyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate;hydrochloride |
| InChI | InChI=1S/C9H19NO3.ClH/c1-6(13-9(2,3)4)7(10)8(11)12-5;/h6-7H,10H2,1-5H3;1H/t6-,7+;/m1./s1 |
| InChIKey | SDHKEUUZUMQSAD-HHQFNNIRSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC)N)OC(C)(C)C.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
