For research use only. Not for therapeutic Use.
HA-CD44 Interaction Inhibitor 2(CAT: I041004), also known as Antitumor agent-108 (compound 5), is a small molecule designed to disrupt the interaction between hyaluronic acid (HA) and the CD44 receptor. This interaction plays a crucial role in tumor growth, invasion, and metastasis. By inhibiting the HA-CD44 binding, this compound effectively disrupts the integrity of cancer spheroids and exhibits antiproliferative activity against cancer cells. Given its mechanism of action, HA-CD44 Interaction Inhibitor 2 is most relevant to Cancer Disease Research, particularly in exploring novel therapeutic strategies targeting tumor microenvironment interactions.
| Catalog Number | I041004 |
| CAS Number | 3009761-01-4 |
| Synonyms | 2-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-5-ol |
| Molecular Formula | C19H23NO4 |
| Purity | ≥95% |
| InChI | InChI=1S/C19H23NO4/c1-22-17-9-13(10-18(23-2)19(17)24-3)11-20-8-7-15-14(12-20)5-4-6-16(15)21/h4-6,9-10,21H,7-8,11-12H2,1-3H3 |
| InChIKey | NUVDZRTYISZXFC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)CN2CCC3=C(C2)C=CC=C3O |
