For research use only. Not for therapeutic Use.
Haginin A is a bioactive compound isolated from the roots of the medicinal plant Pulsatilla cernua. This natural product belongs to the class of flavonoids and exhibits notable pharmacological activities, including anti-inflammatory and antioxidant properties. Research suggests that Haginin A may have potential therapeutic applications in the treatment of inflammatory diseases and oxidative stress-related disorders. Ongoing studies aim to elucidate its mechanisms of action and explore its efficacy and safety profiles, paving the way for its potential use in modern medicine.
| Catalog Number | R066274 |
| CAS Number | 74174-29-1 |
| Molecular Formula | C17H16O5 |
| Purity | ≥95% |
| Target | Plants |
| Storage | -20°C |
| IUPAC Name | 3-(4-hydroxy-2,3-dimethoxyphenyl)-2H-chromen-7-ol |
| InChI | InChI=1S/C17H16O5/c1-20-16-13(5-6-14(19)17(16)21-2)11-7-10-3-4-12(18)8-15(10)22-9-11/h3-8,18-19H,9H2,1-2H3 |
| InChIKey | JGINXZCTOGQYKS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1OC)O)C2=CC3=C(C=C(C=C3)O)OC2 |
