For research use only. Not for therapeutic Use.
Halenaquinone(CAT: I007188) is a naturally occurring marine metabolite isolated from the sponge Xestospongia exigua. It is a potent inhibitor of protein tyrosine phosphatases (PTPs), particularly targeting Cdc25, which is critical in cell cycle regulation. By inhibiting Cdc25 phosphatase, Halenaquinone disrupts cell cycle progression, inducing cell cycle arrest and apoptosis, making it a valuable tool in cancer research. Additionally, Halenaquinone has demonstrated anti-inflammatory, antimicrobial, and antiviral activities, highlighting its diverse biological potential. Its unique structure and multiple bioactivities make it a promising compound for exploring therapeutic targets in oncology, infectious diseases, and inflammation-related disorders.
CAS Number | 86690-14-4 |
Synonyms | Halenaquinone;(S)-12b-methyl-1H-tetrapheno[5,4-bc]furan-3,6,8,11(2H,12bH)-tetraone |
Molecular Formula | C20H12O5 |
Purity | ≥95% |
Target | PI3K inhibitor |
Solubility | Soluble in DMSO |
Storage | -20°C |
IUPAC Name | (1S)-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2(11),3,6,9,13(20),15-hexaene-5,8,12,17-tetrone |
InChI | InChI=1S/C20H12O5/c1-20-5-4-16(23)12-8-25-19(17(12)20)18(24)11-6-9-10(7-13(11)20)15(22)3-2-14(9)21/h2-3,6-8H,4-5H2,1H3/t20-/m0/s1 |
InChIKey | SMGBXXZKAPMTBB-FQEVSTJZSA-N |
SMILES | CC12CCC(=O)C3=COC(=C31)C(=O)C4=C2C=C5C(=O)C=CC(=O)C5=C4 |