For research use only. Not for therapeutic Use.
Halobetasol(CAT: R042086)is a potent, synthetic corticosteroid used topically to treat inflammatory and pruritic skin conditions such as plaque psoriasis and eczema. Classified as a super high-potency (Class I) corticosteroid, it provides fast and effective relief by reducing inflammation, redness, and itching. Halobetasol works by modulating gene expression through glucocorticoid receptor binding, leading to anti-inflammatory effects. Available in creams, ointments, and lotions, it is typically prescribed for short-term use to avoid potential side effects like skin thinning or adrenal suppression.
| CAS Number | 98651-66-2 |
| Synonyms | (6S,8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-chloroacetyl)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| Molecular Formula | C22H27ClF2O4 |
| Purity | ≥95% |
| IUPAC Name | (6S,8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-chloroacetyl)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| InChI | InChI=1S/C22H27ClF2O4/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-19(15,2)21(14,25)17(27)9-20(13,3)22(11,29)18(28)10-23/h4-5,7,11,13-14,16-17,27,29H,6,8-10H2,1-3H3/t11-,13-,14-,16-,17-,19-,20-,21-,22-/m0/s1 |
| InChIKey | LEHFPXVYPMWYQD-XHIJKXOTSA-N |
| SMILES | C[C@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CCl)O)C)O)F)C)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
