For research use only. Not for therapeutic Use.
Halofantrine(Cat No.:M160223)is an antimalarial agent primarily used for the treatment of uncomplicated Plasmodium falciparum malaria. It is a synthetic compound that inhibits the parasite’s ability to metabolize hemoglobin, leading to the accumulation of toxic heme within the parasite and ultimately its death. Halofantrine has good bioavailability but is known for its potential cardiotoxicity, particularly in patients with pre-existing heart conditions or when combined with certain drugs. It is typically administered orally, and close monitoring of cardiac function is recommended during treatment.
CAS Number | 69756-53-2 |
Molecular Formula | C26H30Cl2F3NO |
Purity | ≥95% |
IUPAC Name | 3-(dibutylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]propan-1-ol |
InChI | InChI=1S/C26H30Cl2F3NO/c1-3-5-10-32(11-6-4-2)12-9-25(33)23-16-22-21(14-18(27)15-24(22)28)20-13-17(26(29,30)31)7-8-19(20)23/h7-8,13-16,25,33H,3-6,9-12H2,1-2H3 |
InChIKey | FOHHNHSLJDZUGQ-UHFFFAOYSA-N |
SMILES | CCCCN(CCCC)CCC(C1=C2C=CC(=CC2=C3C=C(C=C(C3=C1)Cl)Cl)C(F)(F)F)O |