For research use only. Not for therapeutic Use.
Haloperidol decanoate(CAT: R011990) is a long-acting injectable form of the antipsychotic medication haloperidol. It is primarily used to manage chronic schizophrenia and other psychiatric disorders in patients who require long-term treatment. As a decanoate ester, it provides extended-release properties, allowing for less frequent dosing, typically once every four weeks. Haloperidol works by blocking dopamine receptors in the brain, helping to reduce symptoms such as hallucinations, delusions, and agitation. The decanoate form is especially beneficial for patients with adherence challenges, ensuring consistent medication levels over time and improving treatment outcomes in chronic mental health management.
| Catalog Number | R011990 |
| CAS Number | 74050-97-8 |
| Synonyms | [4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate |
| Molecular Formula | C31H41ClFNO3 |
| Purity | ≥95% |
| InChI | InChI=1S/C31H41ClFNO3/c1-2-3-4-5-6-7-8-11-30(36)37-31(26-14-16-27(32)17-15-26)20-23-34(24-21-31)22-9-10-29(35)25-12-18-28(33)19-13-25/h12-19H,2-11,20-24H2,1H3 |
| InChIKey | GUTXTARXLVFHDK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OC1(CCN(CC1)CCCC(=O)C2=CC=C(C=C2)F)C3=CC=C(C=C3)Cl |
