For research use only. Not for therapeutic Use.
Haloprogin is a potent antifungal agent. Haloprogin has activity against dermatophytes, Candida spp and a limited number of Gram-positive bacteria[1].
| Catalog Number | R025026 |
| CAS Number | 777-11-7 |
| Synonyms | 1,2,4-trichloro-5-(3-iodoprop-2-ynoxy)benzene |
| Molecular Formula | C9H4Cl3IO |
| Purity | ≥95% |
| InChI | InChI=1S/C9H4Cl3IO/c10-6-4-8(12)9(5-7(6)11)14-3-1-2-13/h4-5H,3H2 |
| InChIKey | CTETYYAZBPJBHE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)OCC#CI |
| Reference | [1]. Harrison EF, et, al. Haloprogin: a topical antifungal agent. Appl Microbiol. 1970 May;19(5):746-50. |
