For research use only. Not for therapeutic Use.
Harman-13C2,15N is a high-purity isotopically labeled compound, featuring two carbon-13 atoms and one nitrogen-15 atom. This labeled version of Harman is crucial for advanced research in biochemistry, pharmacology, and toxicology. The stable isotope labeling ensures precise and reliable analytical results, making it invaluable for NMR spectroscopy and mass spectrometry studies. Harman-13C2,15N is ideal for investigating the metabolic pathways and biological activities of harman, a naturally occurring beta-carboline alkaloid. Its enhanced stability and consistency provide a robust tool for various experimental setups, supporting high-precision scientific investigations and advancing our understanding of harman’s role in biological systems and potential therapeutic applications.
CAS Number | 1189461-56-0 |
Synonyms | 1-Methyl-9H-pyrido[3,4-b]indole-13C2,15N; 3-Methyl-4-carboline-13C2,15N; 2-Methyl-β-carboline-13C2,15N; Aribine-13C2,15N; Loturine-13C2,15N;?Passiflorin-13C2,15N; |
Molecular Formula | C12H10N2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1-methyl-9H-pyrido[3,4-b]indole |
InChI | InChI=1S/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3/i6+1,7+1,13+1 |
InChIKey | PSFDQSOCUJVVGF-NSFXFQGJSA-N |
SMILES | CC1=[15N][13CH]=[13CH]C2=C1NC3=CC=CC=C32 |