For research use only. Not for therapeutic Use.
HAT inhibitor C107 (Cat No.: I012581) is a small-molecule compound that selectively inhibits histone acetyltransferases (HATs), enzymes responsible for acetylating histone proteins and regulating gene expression. By blocking HAT activity, C107 plays a role in epigenetic modulation, impacting transcriptional control in cancer and inflammatory diseases. It has been studied for its potential in suppressing tumor growth, reducing inflammation, and altering cellular differentiation. As an emerging epigenetic regulator, HAT inhibitor C107 is valuable in cancer research and other diseases linked to dysregulated gene expression.
CAS Number | 1417741-58-2 |
Synonyms | (Z)-4-(3-Methyl-5-oxo-4,5-dihydro-4-(4/’,5/’-dimethyl-2/’-nitrobiphen-3-yl)methylene-pyrazol-1-yl)-benzoic acid |
Molecular Formula | C26H21N3O5 |
Purity | ≥95% |
IUPAC Name | 4-[(4Z)-4-[[2-(4,5-dimethyl-2-nitrophenyl)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
InChI | InChI=1S/C26H21N3O5/c1-15-12-23(24(29(33)34)13-16(15)2)21-7-5-4-6-19(21)14-22-17(3)27-28(25(22)30)20-10-8-18(9-11-20)26(31)32/h4-14H,1-3H3,(H,31,32)/b22-14- |
InChIKey | URHRFFODQQGMDN-HMAPJEAMSA-N |
SMILES | CC1=C(C=C(C(=C1)C2=CC=CC=C2C=C3C(=NN(C3=O)C4=CC=C(C=C4)C(=O)O)C)[N+](=O)[O-])C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |