For research use only. Not for therapeutic Use.
HBC is a green fluorescent protein (GFP) fluorophore-like synthetic dye, with a structurally rigid electron acceptor and a strong electron donor. HBC is used to detect RNA localization[1].
HBC is nonfluorescent in solution, but strongly fluoresces upon constraining intramolecular motion[1].
| Catalog Number | I044989 |
| CAS Number | 156840-13-0 |
| Synonyms | 4-[(E)-1-cyano-2-[4-[2-hydroxyethyl(methyl)amino]phenyl]ethenyl]benzonitrile |
| Molecular Formula | C19H17N3O |
| Purity | ≥95% |
| InChI | InChI=1S/C19H17N3O/c1-22(10-11-23)19-8-4-15(5-9-19)12-18(14-21)17-6-2-16(13-20)3-7-17/h2-9,12,23H,10-11H2,1H3/b18-12- |
| InChIKey | DIAVZHWDYXQAFC-PDGQHHTCSA-N |
| SMILES | CN(CCO)C1=CC=C(C=C1)C=C(C#N)C2=CC=C(C=C2)C#N |
| Reference | [1]. Chen X, et al. Visualizing RNA dynamics in live cells with bright and stable fluorescent RNAs. Nat Biotechnol. 2019;37(11):1287-1293. |
