For research use only. Not for therapeutic Use.
HBTU (Cat. No: R059404) is a polypeptide coupling reagent, which is often used as a condensing agent for the reaction of amide condensation. It is mainly used in the organic medicine and chemical industry. It has the advantages of extremely low racemization probability, simple reaction conditions, short reaction time, and high yield.
| Catalog Number | R059404 |
| CAS Number | 94790-37-1 |
| Synonyms | 1-[Bis(dimethylamino)methylene]-1H-benzotriazolium Hexafluorophosphate(1-) 3-Oxide; N-HBTU; |
| Molecular Formula | C11H16F6N5OP |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium;hexafluorophosphate |
| InChI | InChI=1S/C11H16N5O.F6P/c1-14(2)11(15(3)4)17-16-10-8-6-5-7-9(10)12-13-16;1-7(2,3,4,5)6/h5-8H,1-4H3;/q+1;-1 |
| InChIKey | UQYZFNUUOSSNKT-UHFFFAOYSA-N |
| SMILES | CN(C)C(=[N+](C)C)ON1C2=CC=CC=C2N=N1.F[P-](F)(F)(F)(F)F |
