For research use only. Not for therapeutic Use.
HBV-IN-37(CAT: I040679) is a potent small-molecule inhibitor developed to suppress hepatitis B virus (HBV) replication by targeting critical stages of the viral life cycle, such as viral DNA synthesis, capsid assembly, or cccDNA maintenance. It is used extensively in antiviral drug research to explore new therapeutic strategies for chronic hepatitis B infection. HBV-IN-37 has shown strong antiviral activity in preclinical models, making it a valuable tool for studying HBV replication mechanisms and resistance pathways. Its potential use in combination therapy offers promising avenues toward achieving a functional cure for HBV, supporting the development of next-generation antiviral treatments.
| CAS Number | 380483-01-2 |
| Synonyms | 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-4-one |
| Molecular Formula | C23H22ClN3O2S |
| Purity | ≥95% |
| IUPAC Name | 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-4-one |
| InChI | InChI=1S/C23H22ClN3O2S/c24-17-10-8-16(9-11-17)22-20(14-27(25-22)18-5-2-1-3-6-18)23-26(21(28)15-30-23)13-19-7-4-12-29-19/h1-3,5-6,8-11,14,19,23H,4,7,12-13,15H2 |
| InChIKey | HKUHKRJFLLZKRF-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CN2C(SCC2=O)C3=CN(N=C3C4=CC=C(C=C4)Cl)C5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
