For research use only. Not for therapeutic Use.
HC-056456 is a selective antagonist of the transient receptor potential melastatin 5 (TRPM5) ion channel, which plays a crucial role in taste perception and insulin secretion. By inhibiting TRPM5, HC-056456 is primarily used in research to study the physiological functions of this ion channel, particularly in relation to sweet, bitter, and umami taste signaling pathways. Additionally, it is employed in metabolic research to explore the role of TRPM5 in glucose homeostasis and insulin release. The compound’s specificity and efficacy make it a valuable tool for investigating TRPM5’s role in taste sensation and metabolic regulation.
| Catalog Number | I007193 |
| CAS Number | 7733-96-2 |
| Synonyms | [5-oxido-4-(thiophene-2-carbonyl)-1,2,5-oxadiazol-5-ium-3-yl]-thiophen-2-ylmethanone |
| Molecular Formula | C12H6N2O4S2 |
| Purity | ≥95% |
| InChI | InChI=1S/C12H6N2O4S2/c15-11(7-3-1-5-19-7)9-10(14(17)18-13-9)12(16)8-4-2-6-20-8/h1-6H |
| InChIKey | RUQGCDMXFBOTMW-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)C2=NO[N+](=C2C(=O)C3=CC=CS3)[O-] |
