For research use only. Not for therapeutic Use.
HC Blue 12（Cat No.:M114325）is a synthetic dye commonly used in hair coloring products. It belongs to the category of oxidative hair dyes, which develop color when mixed with a developer like hydrogen peroxide. HC Blue 12 is known for providing vibrant blue shades and is often used in combination with other dyes to achieve a wide range of hair colors. It is valued for its stability and ability to produce long-lasting color. Additionally, HC Blue 12 is used in various cosmetic formulations, where precise color control is essential for product effectiveness and appeal.
| Catalog Number | M114325 |
| CAS Number | 132885-85-9 |
| Molecular Formula | C12H20ClN3O4 |
| Purity | ≥95% |
| IUPAC Name | 2-[4-[ethyl(2-hydroxyethyl)amino]-2-nitroanilino]ethanol;hydrochloride |
| InChI | InChI=1S/C12H19N3O4.ClH/c1-2-14(6-8-17)10-3-4-11(13-5-7-16)12(9-10)15(18)19;/h3-4,9,13,16-17H,2,5-8H2,1H3;1H |
| InChIKey | LXKQJEXWFGAMMW-UHFFFAOYSA-N |
| SMILES | CCN(CCO)C1=CC(=C(C=C1)NCCO)[N+](=O)[O-].Cl |
