For research use only. Not for therapeutic Use.
HC toxin(Cat No.:R047492)is a mycotoxin produced by the fungus Helminthosporium carbonum, primarily affecting corn and other cereals. It is known for its phytotoxic properties, leading to necrosis and stunting in plants, which can significantly impact agricultural yields. HC toxin acts by inhibiting protein synthesis, disrupting cellular processes in susceptible plants. Research into its mechanisms has also revealed potential implications in understanding plant-pathogen interactions and developing resistant crop varieties. Additionally, its effects on animal and human health are of interest, particularly regarding exposure and toxicity studies related to contaminated food sources.
Catalog Number | R047492 |
CAS Number | 83209-65-8 |
Synonyms | Toxin I (Helminthosporium carbonum) |
Molecular Formula | C₂₁H₃₂N₄O₆ |
Purity | ≥95% |
Target | Epigenetics |
Storage | -20°C |
IUPAC Name | (3S,6R,9S,12R)-6,9-dimethyl-3-[6-[(2S)-oxiran-2-yl]-6-oxohexyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
InChI | InChI=1S/C21H32N4O6/c1-12-18(27)22-13(2)19(28)24-14(7-4-3-5-9-16(26)17-11-31-17)21(30)25-10-6-8-15(25)20(29)23-12/h12-15,17H,3-11H2,1-2H3,(H,22,27)(H,23,29)(H,24,28)/t12-,13+,14-,15+,17-/m0/s1 |
InChIKey | GNYCTMYOHGBSBI-SVZOTFJBSA-N |
SMILES | C[C@@H]1C(=O)N[C@H](C(=O)N2CCC[C@@H]2C(=O)N[C@H](C(=O)N1)C)CCCCCC(=O)[C@@H]3CO3 |
Reference | 1.Brosch, G.,Ransom, R.,Lechner, T., et al. Inhibition of maize histone deacetylases by HC toxin, the host-selective toxin of Cochliobolus carbonum. Plant Cell 7, 1941-1950 (1995). |