For research use only. Not for therapeutic Use.
hCYP3A4 Fluorogenic Substrate 1（Cat No.:I041126）is a specialized compound used to study the activity of the cytochrome P450 enzyme CYP3A4, which plays a crucial role in drug metabolism. This fluorogenic substrate is designed to be metabolized by CYP3A4, producing a fluorescent signal that allows for real-time monitoring of enzyme activity. It is commonly used in high-throughput screening assays to assess drug interactions, enzyme inhibition, and metabolic pathways. This tool is valuable in drug development for evaluating the pharmacokinetics and potential side effects of new pharmaceutical compounds.
| CAS Number | 186299-00-3 |
| Synonyms | 2-[(4-fluorophenyl)methyl]benzo[de]isoquinoline-1,3-dione |
| Molecular Formula | C19H12FNO2 |
| Purity | ≥95% |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]benzo[de]isoquinoline-1,3-dione |
| InChI | InChI=1S/C19H12FNO2/c20-14-9-7-12(8-10-14)11-21-18(22)15-5-1-3-13-4-2-6-16(17(13)15)19(21)23/h1-10H,11H2 |
| InChIKey | JVHUQBLLHSIOMR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)CC4=CC=C(C=C4)F |
