For research use only. Not for therapeutic Use.
HDAC-IN-4(Cat No.:I005554)is a selective inhibitor of histone deacetylases (HDACs), particularly targeting class I and II HDACs. By inhibiting HDAC activity, HDAC-IN-4 promotes histone acetylation, leading to a more relaxed chromatin structure and altered gene expression. This mechanism can induce cell cycle arrest and apoptosis in cancer cells, making it a potential candidate for cancer therapy. It has shown efficacy in preclinical models of various malignancies, including leukemia and solid tumors. Additionally, HDAC-IN-4 may have applications in neurodegenerative diseases and other disorders linked to dysregulated histone acetylation.
CAS Number | 934828-12-3 |
Synonyms | AZD 9468 |
Molecular Formula | C24H29N5O |
Purity | ≥95% |
Target | Epigenetics |
Solubility | DMSO ≥ 31 mg/mL |
Storage | Store at -20°C |
IUPAC Name | N-(2-aminophenyl)-4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]benzamide |
InChI | InChI=1S/C24H29N5O/c1-17-21(15-28(2)27-17)16-29-13-11-19(12-14-29)18-7-9-20(10-8-18)24(30)26-23-6-4-3-5-22(23)25/h3-10,15,19H,11-14,16,25H2,1-2H3,(H,26,30) |
InChIKey | JHDZMASHNBKTPS-UHFFFAOYSA-N |
SMILES | CC1=NN(C=C1CN2CCC(CC2)C3=CC=C(C=C3)C(=O)NC4=CC=CC=C4N)C |
Reference | [1]. PCT Int. Appl. (2007), WO 2007045844 A1 20070426. |