For research use only. Not for therapeutic Use.
HDAC-IN-40（Cat No.:I043566）is a selective inhibitor of histone deacetylases (HDACs), a class of enzymes involved in modifying proteins by removing acetyl groups from histones, thereby regulating gene expression. By inhibiting HDACs, HDAC-IN-40 can promote the acetylation of histones, leading to the activation of genes that may suppress tumor growth and enhance immune responses. This compound is being studied for its potential therapeutic applications in cancer treatment, particularly in hematologic malignancies and solid tumors. HDAC-IN-40 holds promise in enhancing the effectiveness of other therapies by modulating epigenetic regulation in cancer cells.
| CAS Number | 2463198-51-6 |
| Synonyms | N-[6-(hydroxyamino)-6-oxohexoxy]-3,5-dimethoxybenzamide |
| Molecular Formula | C15H22N2O6 |
| Purity | ≥95% |
| IUPAC Name | N-[6-(hydroxyamino)-6-oxohexoxy]-3,5-dimethoxybenzamide |
| InChI | InChI=1S/C15H22N2O6/c1-21-12-8-11(9-13(10-12)22-2)15(19)17-23-7-5-3-4-6-14(18)16-20/h8-10,20H,3-7H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | WARMWIVORGODLX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)NOCCCCCC(=O)NO)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
