For research use only. Not for therapeutic Use.
HDAC-IN-55(Cat No.:M088818)is a potent and selective inhibitor of histone deacetylases (HDACs), which play a key role in regulating gene expression through the modification of histones. By inhibiting HDAC activity, HDAC-IN-55 promotes histone acetylation, leading to the activation of tumor suppressor genes and the suppression of oncogenes. This compound is of particular interest in cancer research as it exhibits potential anti-tumor effects. HDAC-IN-55 has shown promise in preclinical studies, making it a valuable tool for understanding the therapeutic potential of HDAC inhibition in cancer and other diseases involving aberrant gene expression.
CAS Number | 1268674-16-3 |
Synonyms | 5-(furan-2-yl)-N-(4-pyridin-4-ylbutyl)-1,2-oxazole-3-carboxamide |
Molecular Formula | C17H17N3O3 |
Purity | ≥95% |
IUPAC Name | 5-(furan-2-yl)-N-(4-pyridin-4-ylbutyl)-1,2-oxazole-3-carboxamide |
InChI | InChI=1S/C17H17N3O3/c21-17(14-12-16(23-20-14)15-5-3-11-22-15)19-8-2-1-4-13-6-9-18-10-7-13/h3,5-7,9-12H,1-2,4,8H2,(H,19,21) |
InChIKey | HHXZAPLRXAUTOZ-UHFFFAOYSA-N |
SMILES | C1=COC(=C1)C2=CC(=NO2)C(=O)NCCCCC3=CC=NC=C3 |