For research use only. Not for therapeutic Use.
HDAC3-IN-T247（Cat No.:I012188）is a selective inhibitor of histone deacetylase 3 (HDAC3), an enzyme involved in the regulation of gene expression through the removal of acetyl groups from histones. HDAC3 plays a crucial role in controlling cellular processes like cell differentiation, proliferation, and apoptosis. By inhibiting HDAC3, HDAC3-IN-T247 can potentially modulate epigenetic regulation and restore the expression of genes that may be silenced in diseases like cancer, neurological disorders, and inflammatory conditions. Ongoing research aims to evaluate its therapeutic potential, safety, and efficacy in treating various cancers and other diseases associated with abnormal gene expression.
| CAS Number | 1451042-18-4 |
| Synonyms | N-(2-aminophenyl)-4-[1-(2-thiophen-3-ylethyl)triazol-4-yl]benzamide |
| Molecular Formula | C21H19N5OS |
| Purity | ≥95% |
| IUPAC Name | N-(2-aminophenyl)-4-[1-(2-thiophen-3-ylethyl)triazol-4-yl]benzamide |
| InChI | InChI=1S/C21H19N5OS/c22-18-3-1-2-4-19(18)23-21(27)17-7-5-16(6-8-17)20-13-26(25-24-20)11-9-15-10-12-28-14-15/h1-8,10,12-14H,9,11,22H2,(H,23,27) |
| InChIKey | LBLSLSOENGWIHL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NC(=O)C2=CC=C(C=C2)C3=CN(N=N3)CCC4=CSC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
