For research use only. Not for therapeutic Use.
HDMC(Cat No.:L006734), also known as 2-(2-Hydroxy-3-methoxybenzyl)-4-methylthiazole-5-carboxylic acid, is a chemical compound. It is a thiazole derivative with a unique molecular structure. This compound has garnered interest in pharmaceutical research due to its potential medicinal properties. Thiazole derivatives like HDMC have exhibited various biological activities, making them important in drug discovery. Scientists explore their potential as antimicrobial, antiviral, and anticancer agents. HDMC’s structure suggests it may have interactions with biological targets, making it a subject of study in medicinal chemistry, to develop new drugs and therapies.
CAS Number | 1082951-62-9 |
Molecular Formula | C13H17ClF6N5O2P |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | [(5-chloro-3-oxidobenzotriazol-3-ium-1-yl)-morpholin-4-ylmethylidene]-dimethylazanium;hexafluorophosphate |
InChI | InChI=1S/C13H17ClN5O2.F6P/c1-16(2)13(17-5-7-21-8-6-17)18-11-4-3-10(14)9-12(11)19(20)15-18;1-7(2,3,4,5)6/h3-4,9H,5-8H2,1-2H3;/q+1;-1 |
InChIKey | MGRTWUAUKJMOER-UHFFFAOYSA-N |
SMILES | C[N+](=C(N1CCOCC1)N2C3=C(C=C(C=C3)Cl)[N+](=N2)[O-])C.F[P-](F)(F)(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |