For research use only. Not for therapeutic Use.
HECT E3-IN-1（Cat No.:I041178）is a synthetic compound that acts as an inhibitor targeting E3 ligases in the ubiquitin-proteasome system. It plays a crucial role in regulating protein degradation and various cellular processes, such as cell cycle control, apoptosis, and immune response. By modulating the activity of E3 ligases, HECT E3-IN-1 holds potential in controlling protein homeostasis and has implications for diseases linked to abnormal protein degradation, such as cancer and neurodegenerative disorders. Ongoing research is focused on evaluating its therapeutic potential and refining its use in targeted drug development.
| CAS Number | 1810058-52-6 |
| Synonyms | methyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate |
| Molecular Formula | C21H26N2O4 |
| Purity | ≥95% |
| IUPAC Name | methyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate |
| InChI | InChI=1S/C21H26N2O4/c1-14-20(21(25)22-12-6-9-19(24)27-3)17-13-16(26-2)10-11-18(17)23(14)15-7-4-5-8-15/h6,9-11,13,15H,4-5,7-8,12H2,1-3H3,(H,22,25)/b9-6+ |
| InChIKey | ONZCVJIBENGLKN-RMKNXTFCSA-N |
| SMILES | CC1=C(C2=C(N1C3CCCC3)C=CC(=C2)OC)C(=O)NC/C=C/C(=O)OC |
