For research use only. Not for therapeutic Use.
Helioxanthin 8-1(Cat No.:I005034)is a synthetic analogue of helioxanthin, exhibiting significant antiviral activity against hepatitis B virus (HBV), hepatitis C virus (HCV), herpes simplex virus type 1 (HSV-1), and human immunodeficiency virus (HIV). In vitro studies report EC₅₀ values of >5 μM for HBV, 10 μM for HCV, 1.4 μM for HSV-1, and 15 μM for HIV.Its mechanism involves inhibiting viral replication, making it a promising candidate for further antiviral research and potential therapeutic development.
Catalog Number | I005034 |
CAS Number | 840529-13-7 |
Synonyms | 11-(benzo[d][1,3]dioxol-5-yl)-[1,3]dioxolo[4/’,5/’:3,4]benzo[1,2-g]phthalazine-7,10-diol |
Molecular Formula | C20H12N2O6 |
Purity | ≥95% |
Target | HBV |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | >5/10/1.4/15 uM(HBV/HCV/HSV-1/HIV) |
IUPAC Name | 11-(1,3-benzodioxol-5-yl)-8,9-dihydro-[1,3]benzodioxolo[7,6-g]phthalazine-7,10-dione |
InChI | InChI=1S/C20H12N2O6/c23-19-11-5-9-2-4-13-18(28-8-26-13)16(9)15(17(11)20(24)22-21-19)10-1-3-12-14(6-10)27-7-25-12/h1-6H,7-8H2,(H,21,23)(H,22,24) |
InChIKey | PXSPEYYAEFFUMN-UHFFFAOYSA-N |
SMILES | C1OC2=C(O1)C=C(C=C2)C3=C4C(=CC5=C3C(=O)NNC5=O)C=CC6=C4OCO6 |