For research use only. Not for therapeutic Use.
Hellebrigenin is a cardiac glycoside derived from plants of the Helleborus genus, known for its potent effects on the cardiovascular system. It inhibits Na⁺/K⁺-ATPase, leading to increased intracellular calcium levels, which enhances cardiac contractility. Hellebrigenin has been studied for its potential in heart failure management and its cytotoxic activity against certain cancer cell lines. Its dual role in cardiac research and oncology underscores its importance as a bioactive compound for exploring therapeutic strategies and understanding cellular mechanisms.
| Catalog Number | I017691 |
| CAS Number | 465-90-7 |
| Molecular Formula | C₂₄H₃₂O₆ |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | 4°C, away from moisture and light |
| IUPAC Name | (3S,5S,8R,9S,10S,13R,14S,17R)-3,5,14-trihydroxy-13-methyl-17-(6-oxopyran-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
| InChI | InChI=1S/C24H32O6/c1-21-8-5-18-19(6-10-23(28)12-16(26)4-9-22(18,23)14-25)24(21,29)11-7-17(21)15-2-3-20(27)30-13-15/h2-3,13-14,16-19,26,28-29H,4-12H2,1H3/t16-,17+,18-,19+,21+,22-,23-,24-/m0/s1 |
| InChIKey | TVKPTWJPKVSGJB-XHCIOXAKSA-N |
| SMILES | CC12CCC3C(C1(CCC2C4=COC(=O)C=C4)O)CCC5(C3(CCC(C5)O)C=O)O |
