For research use only. Not for therapeutic Use.
Hematoporphyrin (Cat.No:I001712) is a porphyrin compound derived from red blood cells. It has been used in photodynamic therapy (PDT) for the treatment of certain cancers. When activated by light, hematoporphyrin can generate reactive oxygen species that selectively destroy tumor cells. It is also used as a diagnostic tool for detecting and localizing cancerous lesions.
| CAS Number | 14459-29-1 |
| Molecular Formula | C34H38N4O6 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | DMSO: ≥ 6 mg/mL |
| Storage | -20°C |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8,13-bis(1-hydroxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
| InChI | 1S/C34H38N4O6/c1-15-21(7-9-31(41)42)27-14-28-22(8-10-32(43)44)16(2)24(36-28)12-29-34(20(6)40)18(4)26(38-29)13-30-33(19(5)39)17(3)25(37-30)11-23(15)35-27/h11-14,19-20,37-40H,7-10H2,1-6H3,(H,41,42)(H,43,44) |
| InChIKey | KFKRXESVMDBTNQ-UHFFFAOY |
| SMILES | CC1=C(C2=CC3=NC(=CC4=NC(=CC5=C(C(=C(N5)C=C1N2)C(C)O)C)C(=C4CCC(=O)O)C)C(=C3C)CCC(=O)O)C(C)O |
| Reference | [1]. Olsen, K.W., Affinity chromatography of heme-binding proteins: synthesis and characterization of hematin- and hematoporphyrin-agarose. Methods Enzymol, 1986. 123: p. 324-31. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
