For research use only. Not for therapeutic Use.
Hematoporphyrin Monomethyl Ether(Cat No.:M138288), is a chemical compound used in the field of photodynamic therapy (PDT). It is a derivative of hematoporphyrin, a naturally occurring porphyrin. Hematoporphyrin Monomethyl Ether is a photosensitizer that can be activated by light to produce reactive oxygen species, leading to the destruction of targeted cells, such as cancer cells. It is employed in the treatment of various cancers, including lung, bladder, and esophageal cancer. Hematoporphyrin Monomethyl Ether is administered intravenously and selectively accumulates in tumor tissues, making it an effective tool in PDT-based cancer therapies.
CAS Number | 148471-91-4 |
Molecular Formula | C35H40N4O6 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 4°C, protect from light |
IUPAC Name | 3-[18-(2-carboxyethyl)-8-(1-hydroxyethyl)-13-(1-methoxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
InChI | InChI=1S/C35H40N4O6/c1-16-22(8-10-32(41)42)28-15-29-23(9-11-33(43)44)17(2)25(37-29)13-31-35(21(6)45-7)19(4)27(39-31)14-30-34(20(5)40)18(3)26(38-30)12-24(16)36-28/h12-15,20-21,38-40H,8-11H2,1-7H3,(H,41,42)(H,43,44) |
InChIKey | NDYWLKUTUDKOAS-UHFFFAOYSA-N |
SMILES | CC1=C(C2=CC3=NC(=CC4=NC(=CC5=C(C(=C(N5)C=C1N2)C(C)O)C)C(=C4CCC(=O)O)C)C(=C3C)CCC(=O)O)C(C)OC |