Hemslecin A is a natural compound isolated from the roots of Hemsleya amabilis, a plant traditionally used in Chinese medicine. It belongs to the cucurbitacin family, known for their bioactive properties, particularly in anticancer, anti-inflammatory, and antiviral research. Hemslecin A exhibits potential therapeutic effects through its ability to inhibit cell proliferation and induce apoptosis in certain cancer cell lines. Its unique molecular structure, including steroidal properties, makes it valuable for studying the mechanisms of action in drug discovery. Researchers are investigating its role in cancer therapy, focusing on its ability to modulate key biological pathways involved in tumor growth.
| Catalog Number | R072459 |
| CAS Number | 58546-34-2 |
| Molecular Formula | C32H50O8 |
| Purity | ≥95% |
| IUPAC Name | [(6R)-6-hydroxy-2-methyl-5-oxo-6-[(2S,3S,8S,9R,10R,13R,14S,16R,17R)-2,3,16-trihydroxy-4,4,9,13,14-pentamethyl-11-oxo-1,2,3,7,8,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]heptan-2-yl] acetate |
| InChI | InChI=1S/C32H50O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,19-22,25-26,34-35,38-39H,11-16H2,1-9H3/t19-,20+,21-,22+,25+,26-,29+,30-,31+,32+/m1/s1 |
| InChIKey | LKYNAQSYQLFTCM-GYXNDICUSA-N |
| SMILES | CC(=O)OC(C)(C)CCC(=O)C(C)(C1C(CC2(C1(CC(=O)C3(C2CC=C4C3CC(C(C4(C)C)O)O)C)C)C)O)O |
