For research use only. Not for therapeutic Use.
HEPES (Cat.No:I010715), or N-2-hydroxyethylpiperazine-N’-2-ethanesulfonic acid, is a zwitterionic buffer commonly used in biological and biochemical research. It maintains stable pH levels in cell culture media and biochemical assays. HEPES is known for its good buffering capacity, minimal toxicity, and ability to maintain cell viability and enzyme activity in a wide range of experimental conditions.
| Catalog Number | I010715 |
| CAS Number | 7365-45-9 |
| Synonyms | 4-(2-Hydroxyethyl)piperazine-1-ethanesulfonic acid |
| Molecular Formula | C8H18N2O4S |
| Purity | ≥95% |
| Target | Reagents |
| Solubility | Soluble to 1000 mM in water |
| Storage | Store at RT |
| IUPAC Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid |
| InChI | InChI=1S/C8H18N2O4S/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14/h11H,1-8H2,(H,12,13,14) |
| InChIKey | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCO)CCS(=O)(=O)O |
